C8H14N4 — CID 63293400
N'-[(1-methylimidazol-2-yl)methyl]propanimidamide (PubChem CID 63293400) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N'-[(1-methylimidazol-2-yl)methyl]propanimidamide.
| Compound Name | N'-[(1-methylimidazol-2-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 63293400 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N'-[(1-methylimidazol-2-yl)methyl]propanimidamide |
| SMILES | CC/C(N)=N\Cc1nccn1C |
| InChI | InChI=1S/C8H14N4/c1-3-7(9)11-6-8-10-4-5-12(8)2/h4-5H,3,6H2,1-2H3,(H2,9,11) |
| InChIKey | MULQMABSLOZBNZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|