C14H18N4S — CID 116516017
1-amino-2-[(3-ethylthiophen-2-yl)methyl]-3-phenylguanidine (PubChem CID 116516017) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-amino-2-[(3-ethylthiophen-2-yl)methyl]-3-phenylguanidine.
| Compound Name | 1-amino-2-[(3-ethylthiophen-2-yl)methyl]-3-phenylguanidine |
|---|---|
| PubChem CID | 116516017 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-amino-2-[(3-ethylthiophen-2-yl)methyl]-3-phenylguanidine |
| SMILES | CCc1ccsc1C/N=C(\NN)Nc1ccccc1 |
| InChI | InChI=1S/C14H18N4S/c1-2-11-8-9-19-13(11)10-16-14(18-15)17-12-6-4-3-5-7-12/h3-9H,2,10,15H2,1H3,(H2,16,17,18) |
| InChIKey | DPMPHBGYPNZEBW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|