C15H21NO2 — CID 11651707
(E,2S)-N-tert-butyl-2-hydroxy-3-methyl-4-phenylbut-3-enamide (PubChem CID 11651707) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (E,2S)-N-tert-butyl-2-hydroxy-3-methyl-4-phenylbut-3-enamide.
| Compound Name | (E,2S)-N-tert-butyl-2-hydroxy-3-methyl-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 11651707 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (E,2S)-N-tert-butyl-2-hydroxy-3-methyl-4-phenylbut-3-enamide |
| SMILES | C/C(=C\c1ccccc1)[C@H](O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H21NO2/c1-11(10-12-8-6-5-7-9-12)13(17)14(18)16-15(2,3)4/h5-10,13,17H,1-4H3,(H,16,18)/b11-10+/t13-/m0/s1 |
| InChIKey | GBFVDYWZXVEWRT-NHAQELONSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |