C11H6F2N2O3 — CID 116520126
4-(3,4-difluorobenzoyl)-1H-imidazole-5-carboxylic acid (PubChem CID 116520126) has the molecular formula C11H6F2N2O3 and a molecular weight of 252.18 g/mol. Its IUPAC name is 4-(3,4-difluorobenzoyl)-1H-imidazole-5-carboxylic acid.
| Compound Name | 4-(3,4-difluorobenzoyl)-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 116520126 |
| Molecular Formula | C11H6F2N2O3 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-(3,4-difluorobenzoyl)-1H-imidazole-5-carboxylic acid |
| SMILES | O=C(c1ccc(F)c(F)c1)c1nc[nH]c1C(=O)O |
| InChI | InChI=1S/C11H6F2N2O3/c12-6-2-1-5(3-7(6)13)10(16)8-9(11(17)18)15-4-14-8/h1-4H,(H,14,15)(H,17,18) |
| InChIKey | GEOXWEFFEXKLAN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |