C11H18OSn — CID 11652128
trimethyl-[(1S,5R)-9-oxabicyclo[3.3.1]nona-2,6-dien-1-yl]stannane (PubChem CID 11652128) has the molecular formula C11H18OSn and a molecular weight of 284.97 g/mol. Its IUPAC name is trimethyl-[(1S,5R)-9-oxabicyclo[3.3.1]nona-2,6-dien-1-yl]stannane.
| Compound Name | trimethyl-[(1S,5R)-9-oxabicyclo[3.3.1]nona-2,6-dien-1-yl]stannane |
|---|---|
| PubChem CID | 11652128 |
| Molecular Formula | C11H18OSn |
| Molecular Weight | 284.97 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | trimethyl-[(1S,5R)-9-oxabicyclo[3.3.1]nona-2,6-dien-1-yl]stannane |
| SMILES | C[Sn](C)(C)[C@]12C=CC[C@H](C=CC1)O2 |
| InChI | InChI=1S/C8H9O.3CH3.Sn/c1-3-7-5-2-6-8(4-1)9-7;;;;/h1-3,6-7H,4-5H2;3*1H3;/t7-;;;;/m0..../s1 |
| InChIKey | CXSREUUOZGOSMQ-HEDVWWMMSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.97 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|