C14H20N2O3 — CID 116521381
1-(5,5-dimethyloxolan-2-yl)-N-[(2-nitrophenyl)methyl]methanamine (PubChem CID 116521381) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(5,5-dimethyloxolan-2-yl)-N-[(2-nitrophenyl)methyl]methanamine.
| Compound Name | 1-(5,5-dimethyloxolan-2-yl)-N-[(2-nitrophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 116521381 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(5,5-dimethyloxolan-2-yl)-N-[(2-nitrophenyl)methyl]methanamine |
| SMILES | CC1(C)CCC(CNCc2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2)8-7-12(19-14)10-15-9-11-5-3-4-6-13(11)16(17)18/h3-6,12,15H,7-10H2,1-2H3 |
| InChIKey | ZGOUNOMPFGDJLA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|