C13H16N2O3 — CID 62065649
1-(3,4-dihydro-2H-pyran-2-yl)-N-[(2-nitrophenyl)methyl]methanamine (PubChem CID 62065649) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-2-yl)-N-[(2-nitrophenyl)methyl]methanamine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-2-yl)-N-[(2-nitrophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 62065649 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-2-yl)-N-[(2-nitrophenyl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1ccccc1CNCC1CCC=CO1 |
| InChI | InChI=1S/C13H16N2O3/c16-15(17)13-7-2-1-5-11(13)9-14-10-12-6-3-4-8-18-12/h1-2,4-5,7-8,12,14H,3,6,9-10H2 |
| InChIKey | QPOHVTLCKKXCHL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|