C16H25NO2 — CID 116521401
N-[(5,5-dimethyloxolan-2-yl)methyl]-4-propoxyaniline (PubChem CID 116521401) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[(5,5-dimethyloxolan-2-yl)methyl]-4-propoxyaniline.
| Compound Name | N-[(5,5-dimethyloxolan-2-yl)methyl]-4-propoxyaniline |
|---|---|
| PubChem CID | 116521401 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[(5,5-dimethyloxolan-2-yl)methyl]-4-propoxyaniline |
| SMILES | CCCOc1ccc(NCC2CCC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-4-11-18-14-7-5-13(6-8-14)17-12-15-9-10-16(2,3)19-15/h5-8,15,17H,4,9-12H2,1-3H3 |
| InChIKey | SXLMOIXHPQOALQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|