C17H25ClO3 — CID 116522374
5-[[2-(chloromethyl)-5-propoxyphenoxy]methyl]-2,2-dimethyloxolane (PubChem CID 116522374) has the molecular formula C17H25ClO3 and a molecular weight of 312.84 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)-5-propoxyphenoxy]methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[[2-(chloromethyl)-5-propoxyphenoxy]methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116522374 |
| Molecular Formula | C17H25ClO3 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-[[2-(chloromethyl)-5-propoxyphenoxy]methyl]-2,2-dimethyloxolane |
| SMILES | CCCOc1ccc(CCl)c(OCC2CCC(C)(C)O2)c1 |
| InChI | InChI=1S/C17H25ClO3/c1-4-9-19-14-6-5-13(11-18)16(10-14)20-12-15-7-8-17(2,3)21-15/h5-6,10,15H,4,7-9,11-12H2,1-3H3 |
| InChIKey | SBIUPLCSOYWKLU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|