C16H34O2Si — CID 11652161
[(2S,3R)-3-heptyl-3-triethylsilyloxiran-2-yl]methanol (PubChem CID 11652161) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is [(2S,3R)-3-heptyl-3-triethylsilyloxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-heptyl-3-triethylsilyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11652161 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | [(2S,3R)-3-heptyl-3-triethylsilyloxiran-2-yl]methanol |
| SMILES | CCCCCCC[C@]1([Si](CC)(CC)CC)O[C@H]1CO |
| InChI | InChI=1S/C16H34O2Si/c1-5-9-10-11-12-13-16(15(14-17)18-16)19(6-2,7-3)8-4/h15,17H,5-14H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | PXJYEXGASFKDFC-JKSUJKDBSA-N |
| XLogP | 4.52 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|