4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid

C12H23NO3 — CID 116522700

IUPAC4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid
SMILESCN(CCCC(=O)O)CC1CCC(C)(C)O1
InChIInChI=1S/C12H23NO3/c1-12(2)7-6-10(16-12)9-13(3)8-4-5-11(14)15/h10H,4-9H2,1-3H3,(H,14,15)
InChIKeyWHDDLOSLYRQANX-UHFFFAOYSA-N
MW229.32 g/mol
LogP1.74
Rot. Bonds6

About 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid

4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid (PubChem CID 116522700) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid.

Molecular Properties

Compound Name4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid
PubChem CID116522700
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Name4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid
SMILESCN(CCCC(=O)O)CC1CCC(C)(C)O1
InChIInChI=1S/C12H23NO3/c1-12(2)7-6-10(16-12)9-13(3)8-4-5-11(14)15/h10H,4-9H2,1-3H3,(H,14,15)
InChIKeyWHDDLOSLYRQANX-UHFFFAOYSA-N
XLogP1.74
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 51.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
The IUPAC name of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid (CID 116522700) is 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid.
What is the SMILES notation for 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
The canonical SMILES for 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid is CN(CCCC(=O)O)CC1CCC(C)(C)O1.
What is the InChIKey of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
The InChIKey is WHDDLOSLYRQANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-12(2)7-6-10(16-12)9-13(3)8-4-5-11(14)15/h10H,4-9H2,1-3H3,(H,14,15).
What are the key properties of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid has a molecular weight of 229.32 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid is sourced from PubChem (CID 116522700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).