About 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid
4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid (PubChem CID 116522700) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid.
Analyze 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
The IUPAC name of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid (CID 116522700) is 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid.
What is the SMILES notation for 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
The canonical SMILES for 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid is CN(CCCC(=O)O)CC1CCC(C)(C)O1.
What is the InChIKey of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
The InChIKey is WHDDLOSLYRQANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-12(2)7-6-10(16-12)9-13(3)8-4-5-11(14)15/h10H,4-9H2,1-3H3,(H,14,15).
What are the key properties of 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid?
4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid has a molecular weight of 229.32 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanoic acid is sourced from PubChem (CID 116522700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).