About 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid
2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid (PubChem CID 116522678) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid.
Molecular Properties
| Compound Name | 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid |
| PubChem CID | 116522678 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)CC2CCC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-12-4-6-13(7-5-12)17(11-15(18)19)10-14-8-9-16(2,3)20-14/h4-7,14H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | SJXISPQVXQFEFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid?
The IUPAC name of 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid (CID 116522678) is 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid.
What is the SMILES notation for 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid?
The canonical SMILES for 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid is Cc1ccc(N(CC(=O)O)CC2CCC(C)(C)O2)cc1.
What is the InChIKey of 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid?
The InChIKey is SJXISPQVXQFEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-12-4-6-13(7-5-12)17(11-15(18)19)10-14-8-9-16(2,3)20-14/h4-7,14H,8-11H2,1-3H3,(H,18,19).
What are the key properties of 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid?
2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid has a molecular weight of 277.36 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid is sourced from PubChem (CID 116522678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).