C16H23NO3 — CID 116522678
2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid (PubChem CID 116522678) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid.
| Compound Name | 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid |
|---|---|
| PubChem CID | 116522678 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-[N-[(5,5-dimethyloxolan-2-yl)methyl]-4-methylanilino]acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)CC2CCC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-12-4-6-13(7-5-12)17(11-15(18)19)10-14-8-9-16(2,3)20-14/h4-7,14H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | SJXISPQVXQFEFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|