C14H28N2O — CID 116524415
1-[(5,5-dimethyloxolan-2-yl)methyl]-3-propylpiperazine (PubChem CID 116524415) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-[(5,5-dimethyloxolan-2-yl)methyl]-3-propylpiperazine.
| Compound Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-3-propylpiperazine |
|---|---|
| PubChem CID | 116524415 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-3-propylpiperazine |
| SMILES | CCCC1CN(CC2CCC(C)(C)O2)CCN1 |
| InChI | InChI=1S/C14H28N2O/c1-4-5-12-10-16(9-8-15-12)11-13-6-7-14(2,3)17-13/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | QOVXWLNVNVUYJT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |