C13H25ClO — CID 116525259
5-[2-(chloromethyl)-2,3-dimethylbutyl]-2,2-dimethyloxolane (PubChem CID 116525259) has the molecular formula C13H25ClO and a molecular weight of 232.79 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-2,3-dimethylbutyl]-2,2-dimethyloxolane.
| Compound Name | 5-[2-(chloromethyl)-2,3-dimethylbutyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525259 |
| Molecular Formula | C13H25ClO |
| Molecular Weight | 232.79 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-[2-(chloromethyl)-2,3-dimethylbutyl]-2,2-dimethyloxolane |
| SMILES | CC(C)C(C)(CCl)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C13H25ClO/c1-10(2)13(5,9-14)8-11-6-7-12(3,4)15-11/h10-11H,6-9H2,1-5H3 |
| InChIKey | SGQKUPCLTLBFGO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|