C16H22Cl2O — CID 116525315
5-[3-chloro-2-(chloromethyl)-2-phenylpropyl]-2,2-dimethyloxolane (PubChem CID 116525315) has the molecular formula C16H22Cl2O and a molecular weight of 301.26 g/mol. Its IUPAC name is 5-[3-chloro-2-(chloromethyl)-2-phenylpropyl]-2,2-dimethyloxolane.
| Compound Name | 5-[3-chloro-2-(chloromethyl)-2-phenylpropyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525315 |
| Molecular Formula | C16H22Cl2O |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-[3-chloro-2-(chloromethyl)-2-phenylpropyl]-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(CC(CCl)(CCl)c2ccccc2)O1 |
| InChI | InChI=1S/C16H22Cl2O/c1-15(2)9-8-14(19-15)10-16(11-17,12-18)13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3 |
| InChIKey | LCPGJACOJYRUMA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|