C16H24O3 — CID 116525293
2-[(5,5-dimethyloxolan-2-yl)methyl]-2-phenylpropane-1,3-diol (PubChem CID 116525293) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methyl]-2-phenylpropane-1,3-diol.
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methyl]-2-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 116525293 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methyl]-2-phenylpropane-1,3-diol |
| SMILES | CC1(C)CCC(CC(CO)(CO)c2ccccc2)O1 |
| InChI | InChI=1S/C16H24O3/c1-15(2)9-8-14(19-15)10-16(11-17,12-18)13-6-4-3-5-7-13/h3-7,14,17-18H,8-12H2,1-2H3 |
| InChIKey | AMIZAVMTWPETSY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |