C12H13BrFNO4S — CID 116527308
2-[(4-bromo-2-fluorophenyl)sulfonylamino]-2-cyclopropylpropanoic acid (PubChem CID 116527308) has the molecular formula C12H13BrFNO4S and a molecular weight of 366.21 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)sulfonylamino]-2-cyclopropylpropanoic acid.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)sulfonylamino]-2-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 116527308 |
| Molecular Formula | C12H13BrFNO4S |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)sulfonylamino]-2-cyclopropylpropanoic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(Br)cc1F)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H13BrFNO4S/c1-12(11(16)17,7-2-3-7)15-20(18,19)10-5-4-8(13)6-9(10)14/h4-7,15H,2-3H2,1H3,(H,16,17) |
| InChIKey | OWVBNHAJCLZVDK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |