C18H19NO5 — CID 11652821
[(2S)-4-(4-nitrophenyl)-2-[(1R,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-yn-2-yl] acetate (PubChem CID 11652821) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is [(2S)-4-(4-nitrophenyl)-2-[(1R,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-yn-2-yl] acetate.
| Compound Name | [(2S)-4-(4-nitrophenyl)-2-[(1R,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 11652821 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [(2S)-4-(4-nitrophenyl)-2-[(1R,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-yn-2-yl] acetate |
| SMILES | CC(=O)O[C@@](C)(C#Cc1ccc([N+](=O)[O-])cc1)[C@@]12CCCC[C@@H]1O2 |
| InChI | InChI=1S/C18H19NO5/c1-13(20)23-17(2,18-11-4-3-5-16(18)24-18)12-10-14-6-8-15(9-7-14)19(21)22/h6-9,16H,3-5,11H2,1-2H3/t16-,17-,18+/m0/s1 |
| InChIKey | LRKNLTTYKWGESO-OKZBNKHCSA-N |
| XLogP | 2.98 |
| TPSA | 81.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|