C18H21Cl2NO4 — CID 21234180
2-(7,7-dichloro-6-methyl-3-bicyclo[4.1.0]heptanyl)propan-2-yl 4-nitrobenzoate (PubChem CID 21234180) has the molecular formula C18H21Cl2NO4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 2-(7,7-dichloro-6-methyl-3-bicyclo[4.1.0]heptanyl)propan-2-yl 4-nitrobenzoate.
| Compound Name | 2-(7,7-dichloro-6-methyl-3-bicyclo[4.1.0]heptanyl)propan-2-yl 4-nitrobenzoate |
|---|---|
| PubChem CID | 21234180 |
| Molecular Formula | C18H21Cl2NO4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-(7,7-dichloro-6-methyl-3-bicyclo[4.1.0]heptanyl)propan-2-yl 4-nitrobenzoate |
| SMILES | CC(C)(OC(=O)c1ccc([N+](=O)[O-])cc1)C1CCC2(C)C(C1)C2(Cl)Cl |
| InChI | InChI=1S/C18H21Cl2NO4/c1-16(2,12-8-9-17(3)14(10-12)18(17,19)20)25-15(22)11-4-6-13(7-5-11)21(23)24/h4-7,12,14H,8-10H2,1-3H3 |
| InChIKey | VGQBYQSGQVNTDS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|