About 2-nitrosopropan-2-yl 4-nitrobenzoate
2-nitrosopropan-2-yl 4-nitrobenzoate (PubChem CID 58488526) has the molecular formula C10H10N2O5
and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-nitrosopropan-2-yl 4-nitrobenzoate.
Molecular Properties
| Compound Name | 2-nitrosopropan-2-yl 4-nitrobenzoate |
| PubChem CID | 58488526 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-nitrosopropan-2-yl 4-nitrobenzoate |
| SMILES | CC(C)(N=O)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H10N2O5/c1-10(2,11-14)17-9(13)7-3-5-8(6-4-7)12(15)16/h3-6H,1-2H3 |
| InChIKey | QMPZWIYIOBSCDM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrosopropan-2-yl 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosopropan-2-yl 4-nitrobenzoate?
The IUPAC name of 2-nitrosopropan-2-yl 4-nitrobenzoate (CID 58488526) is 2-nitrosopropan-2-yl 4-nitrobenzoate.
What is the SMILES notation for 2-nitrosopropan-2-yl 4-nitrobenzoate?
The canonical SMILES for 2-nitrosopropan-2-yl 4-nitrobenzoate is CC(C)(N=O)OC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-nitrosopropan-2-yl 4-nitrobenzoate?
The InChIKey is QMPZWIYIOBSCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5/c1-10(2,11-14)17-9(13)7-3-5-8(6-4-7)12(15)16/h3-6H,1-2H3.
What are the key properties of 2-nitrosopropan-2-yl 4-nitrobenzoate?
2-nitrosopropan-2-yl 4-nitrobenzoate has a molecular weight of 238.20 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosopropan-2-yl 4-nitrobenzoate is sourced from PubChem (CID 58488526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).