C24H17F6NO4 — CID 101172812
[1-[3,5-bis(trifluoromethyl)phenyl]-1-(4-methylphenyl)ethyl] 4-nitrobenzoate (PubChem CID 101172812) has the molecular formula C24H17F6NO4 and a molecular weight of 497.39 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]-1-(4-methylphenyl)ethyl] 4-nitrobenzoate.
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]-1-(4-methylphenyl)ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 101172812 |
| Molecular Formula | C24H17F6NO4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]-1-(4-methylphenyl)ethyl] 4-nitrobenzoate |
| SMILES | Cc1ccc(C(C)(OC(=O)c2ccc([N+](=O)[O-])cc2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H17F6NO4/c1-14-3-7-16(8-4-14)22(2,35-21(32)15-5-9-20(10-6-15)31(33)34)17-11-18(23(25,26)27)13-19(12-17)24(28,29)30/h3-13H,1-2H3 |
| InChIKey | WOOYCAFKLZTYAL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|