C19H21NO5 — CID 98555221
[(1R,6R,8S,10R,13R)-9-oxatetracyclo[6.3.2.01,6.06,10]tridecan-13-yl] 4-nitrobenzoate (PubChem CID 98555221) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [(1R,6R,8S,10R,13R)-9-oxatetracyclo[6.3.2.01,6.06,10]tridecan-13-yl] 4-nitrobenzoate.
| Compound Name | [(1R,6R,8S,10R,13R)-9-oxatetracyclo[6.3.2.01,6.06,10]tridecan-13-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 98555221 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(1R,6R,8S,10R,13R)-9-oxatetracyclo[6.3.2.01,6.06,10]tridecan-13-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1C[C@]23CCCC[C@@]24C[C@@H]1O[C@@H]4C3)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21NO5/c21-17(12-3-5-13(6-4-12)20(22)23)25-14-9-18-7-1-2-8-19(18)10-15(14)24-16(19)11-18/h3-6,14-16H,1-2,7-11H2/t14-,15+,16-,18+,19+/m1/s1 |
| InChIKey | XMYLNJHLYQFDBD-LHHMMCJZSA-N |
| XLogP | 3.63 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|