C19H21NO4 — CID 100895315
[(1S,6S,11R)-11-tricyclo[4.4.2.01,6]dodec-3-enyl] 4-nitrobenzoate (PubChem CID 100895315) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is [(1S,6S,11R)-11-tricyclo[4.4.2.01,6]dodec-3-enyl] 4-nitrobenzoate.
| Compound Name | [(1S,6S,11R)-11-tricyclo[4.4.2.01,6]dodec-3-enyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 100895315 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [(1S,6S,11R)-11-tricyclo[4.4.2.01,6]dodec-3-enyl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1C[C@]23CC=CC[C@]12CCCC3)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21NO4/c21-17(14-5-7-15(8-6-14)20(22)23)24-16-13-18-9-1-3-11-19(16,18)12-4-2-10-18/h1,3,5-8,16H,2,4,9-13H2/t16-,18-,19+/m1/s1 |
| InChIKey | GHVXUURYWQXWHI-QRQLOZEOSA-N |
| XLogP | 4.42 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|