C14H14BrFN2O2S — CID 116528774
4-bromo-N-[(3-ethyl-2-pyridinyl)methyl]-2-fluorobenzenesulfonamide (PubChem CID 116528774) has the molecular formula C14H14BrFN2O2S and a molecular weight of 373.25 g/mol. Its IUPAC name is 4-bromo-N-[(3-ethyl-2-pyridinyl)methyl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-[(3-ethyl-2-pyridinyl)methyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116528774 |
| Molecular Formula | C14H14BrFN2O2S |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 4-bromo-N-[(3-ethyl-2-pyridinyl)methyl]-2-fluorobenzenesulfonamide |
| SMILES | CCc1cccnc1CNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H14BrFN2O2S/c1-2-10-4-3-7-17-13(10)9-18-21(19,20)14-6-5-11(15)8-12(14)16/h3-8,18H,2,9H2,1H3 |
| InChIKey | UDXWXLIOXVDVDC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |