C12H13FN2 — CID 116531183
1-(ethylamino)-5-fluoro-2,3-dihydroindene-1-carbonitrile (PubChem CID 116531183) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 1-(ethylamino)-5-fluoro-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 1-(ethylamino)-5-fluoro-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 116531183 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1-(ethylamino)-5-fluoro-2,3-dihydroindene-1-carbonitrile |
| SMILES | CCNC1(C#N)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H13FN2/c1-2-15-12(8-14)6-5-9-7-10(13)3-4-11(9)12/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | KSFQBKNFMDVQNN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |