C12H12FNO4S — CID 116532381
7-fluoro-1,1-dioxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid (PubChem CID 116532381) has the molecular formula C12H12FNO4S and a molecular weight of 285.30 g/mol. Its IUPAC name is 7-fluoro-1,1-dioxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid.
| Compound Name | 7-fluoro-1,1-dioxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 116532381 |
| Molecular Formula | C12H12FNO4S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 7-fluoro-1,1-dioxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)(=O)C2Cc3cc(F)ccc3C2N1 |
| InChI | InChI=1S/C12H12FNO4S/c13-7-1-2-8-6(3-7)4-10-11(8)14-9(12(15)16)5-19(10,17)18/h1-3,9-11,14H,4-5H2,(H,15,16) |
| InChIKey | IUQVRLSKCIQJML-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |