C11H9FO3 — CID 139765749
3-(3-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoic acid (PubChem CID 139765749) has the molecular formula C11H9FO3 and a molecular weight of 208.19 g/mol. Its IUPAC name is 3-(3-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoic acid.
| Compound Name | 3-(3-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 139765749 |
| Molecular Formula | C11H9FO3 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-(3-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)C1Cc2cc(F)ccc21 |
| InChI | InChI=1S/C11H9FO3/c12-7-1-2-8-6(3-7)4-9(8)10(13)5-11(14)15/h1-3,9H,4-5H2,(H,14,15) |
| InChIKey | MOCCFRBIUJUHIN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|