C19H20N2O5 — CID 11653317
(2S)-2-[6-(2-hydroxyethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid (PubChem CID 11653317) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2S)-2-[6-(2-hydroxyethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid.
| Compound Name | (2S)-2-[6-(2-hydroxyethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 11653317 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2S)-2-[6-(2-hydroxyethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid |
| SMILES | CCC[C@@H](C(=O)O)N1C(=O)c2cccc3c(NCCO)ccc(c23)C1=O |
| InChI | InChI=1S/C19H20N2O5/c1-2-4-15(19(25)26)21-17(23)12-6-3-5-11-14(20-9-10-22)8-7-13(16(11)12)18(21)24/h3,5-8,15,20,22H,2,4,9-10H2,1H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | DJCPNEXJEMXYKG-HNNXBMFYSA-N |
| XLogP | 2.09 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|