C31H33F3N3O6+ — CID 135800914
(2R)-2-[6-[(1-benzylpiperidin-1-ium-4-yl)amino]-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 135800914) has the molecular formula C31H33F3N3O6+ and a molecular weight of 600.61 g/mol. Its IUPAC name is (2R)-2-[6-[(1-benzylpiperidin-1-ium-4-yl)amino]-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-[6-[(1-benzylpiperidin-1-ium-4-yl)amino]-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135800914 |
| Molecular Formula | C31H33F3N3O6+ |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | (2R)-2-[6-[(1-benzylpiperidin-1-ium-4-yl)amino]-1,3-dioxobenzo[de]isoquinolin-2-yl]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCC[C@H](C(=O)O)N1C(=O)c2cccc3c(NC4CC[NH+](Cc5ccccc5)CC4)ccc(c23)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H31N3O4.C2HF3O2/c1-2-7-25(29(35)36)32-27(33)22-11-6-10-21-24(13-12-23(26(21)22)28(32)34)30-20-14-16-31(17-15-20)18-19-8-4-3-5-9-19;3-2(4,5)1(6)7/h3-6,8-13,20,25,30H,2,7,14-18H2,1H3,(H,35,36);(H,6,7)/p+1/t25-;/m1./s1 |
| InChIKey | UQMBZSCKFPVVAL-VQIWEWKSSA-O |
| XLogP | 3.98 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|