C29H24ClN3O2 — CID 11548873
6-[(1-benzylpyrrolidin-3-yl)amino]-2-(3-chlorophenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 11548873) has the molecular formula C29H24ClN3O2 and a molecular weight of 481.98 g/mol. Its IUPAC name is 6-[(1-benzylpyrrolidin-3-yl)amino]-2-(3-chlorophenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[(1-benzylpyrrolidin-3-yl)amino]-2-(3-chlorophenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 11548873 |
| Molecular Formula | C29H24ClN3O2 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 6-[(1-benzylpyrrolidin-3-yl)amino]-2-(3-chlorophenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(NC4CCN(Cc5ccccc5)C4)ccc(c23)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H24ClN3O2/c30-20-8-4-9-22(16-20)33-28(34)24-11-5-10-23-26(13-12-25(27(23)24)29(33)35)31-21-14-15-32(18-21)17-19-6-2-1-3-7-19/h1-13,16,21,31H,14-15,17-18H2 |
| InChIKey | BAGJWWXRGCHESF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|