C27H23ClN2O3 — CID 142659089
3-[(1-benzylpyrrolidin-3-yl)amino]-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 142659089) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is 3-[(1-benzylpyrrolidin-3-yl)amino]-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1-benzylpyrrolidin-3-yl)amino]-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659089 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3-[(1-benzylpyrrolidin-3-yl)amino]-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NC2CCN(Cc3ccccc3)C2)c(-c2ccc(Cl)cc2Oc2ccccc2)c1=O |
| InChI | InChI=1S/C27H23ClN2O3/c28-19-11-12-22(23(15-19)33-21-9-5-2-6-10-21)24-25(27(32)26(24)31)29-20-13-14-30(17-20)16-18-7-3-1-4-8-18/h1-12,15,20,29H,13-14,16-17H2 |
| InChIKey | FDWNPZHCRNJWBF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|