C21H24N4O2 — CID 11653471
1-(8-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea (PubChem CID 11653471) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(8-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-(8-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 11653471 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(8-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea |
| SMILES | CC(C)(C)c1cccc2c1OCCC2NC(=O)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C21H24N4O2/c1-21(2,3)15-7-4-6-13-17(10-11-27-19(13)15)24-20(26)23-16-8-5-9-18-14(16)12-22-25-18/h4-9,12,17H,10-11H2,1-3H3,(H,22,25)(H2,23,24,26) |
| InChIKey | FGVFFUSBPJFGCF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |