C20H19F3N4O — CID 66551873
1-(1H-indazol-4-yl)-3-[(1S,3R)-3-[4-(trifluoromethyl)phenyl]cyclopentyl]urea (PubChem CID 66551873) has the molecular formula C20H19F3N4O and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-[(1S,3R)-3-[4-(trifluoromethyl)phenyl]cyclopentyl]urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-[(1S,3R)-3-[4-(trifluoromethyl)phenyl]cyclopentyl]urea |
|---|---|
| PubChem CID | 66551873 |
| Molecular Formula | C20H19F3N4O |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-[(1S,3R)-3-[4-(trifluoromethyl)phenyl]cyclopentyl]urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)N[C@H]1CC[C@@H](c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19F3N4O/c21-20(22,23)14-7-4-12(5-8-14)13-6-9-15(10-13)25-19(28)26-17-2-1-3-18-16(17)11-24-27-18/h1-5,7-8,11,13,15H,6,9-10H2,(H,24,27)(H2,25,26,28)/t13-,15+/m1/s1 |
| InChIKey | NKALKRMYMAIVGL-HIFRSBDPSA-N |
| XLogP | 5.04 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |