C24H30N4O — CID 66551491
1-[3-(4-tert-butylphenyl)cyclohexyl]-3-(1H-indazol-4-yl)urea (PubChem CID 66551491) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)cyclohexyl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[3-(4-tert-butylphenyl)cyclohexyl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 66551491 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)cyclohexyl]-3-(1H-indazol-4-yl)urea |
| SMILES | CC(C)(C)c1ccc(C2CCCC(NC(=O)Nc3cccc4[nH]ncc34)C2)cc1 |
| InChI | InChI=1S/C24H30N4O/c1-24(2,3)18-12-10-16(11-13-18)17-6-4-7-19(14-17)26-23(29)27-21-8-5-9-22-20(21)15-25-28-22/h5,8-13,15,17,19H,4,6-7,14H2,1-3H3,(H,25,28)(H2,26,27,29) |
| InChIKey | SWTVJTQZGUXESH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |