C13H16BrF3N2O — CID 116535475
2-(2-bromoanilino)-6,6,6-trifluoro-2-methylhexanamide (PubChem CID 116535475) has the molecular formula C13H16BrF3N2O and a molecular weight of 353.18 g/mol. Its IUPAC name is 2-(2-bromoanilino)-6,6,6-trifluoro-2-methylhexanamide.
| Compound Name | 2-(2-bromoanilino)-6,6,6-trifluoro-2-methylhexanamide |
|---|---|
| PubChem CID | 116535475 |
| Molecular Formula | C13H16BrF3N2O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-(2-bromoanilino)-6,6,6-trifluoro-2-methylhexanamide |
| SMILES | CC(CCCC(F)(F)F)(Nc1ccccc1Br)C(N)=O |
| InChI | InChI=1S/C13H16BrF3N2O/c1-12(11(18)20,7-4-8-13(15,16)17)19-10-6-3-2-5-9(10)14/h2-3,5-6,19H,4,7-8H2,1H3,(H2,18,20) |
| InChIKey | HEOANCJXQLRJHE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |