C14H18F4N2O — CID 116535507
6,6,6-trifluoro-2-(3-fluoro-5-methylanilino)-2-methylhexanamide (PubChem CID 116535507) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-(3-fluoro-5-methylanilino)-2-methylhexanamide.
| Compound Name | 6,6,6-trifluoro-2-(3-fluoro-5-methylanilino)-2-methylhexanamide |
|---|---|
| PubChem CID | 116535507 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 6,6,6-trifluoro-2-(3-fluoro-5-methylanilino)-2-methylhexanamide |
| SMILES | Cc1cc(F)cc(NC(C)(CCCC(F)(F)F)C(N)=O)c1 |
| InChI | InChI=1S/C14H18F4N2O/c1-9-6-10(15)8-11(7-9)20-13(2,12(19)21)4-3-5-14(16,17)18/h6-8,20H,3-5H2,1-2H3,(H2,19,21) |
| InChIKey | DNEMZMYSJMKMIP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |