C10H18N2O4 — CID 116536490
2-[(2-amino-2-oxoethyl)-methylcarbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 116536490) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-methylcarbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-methylcarbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116536490 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-methylcarbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | CN(CC(N)=O)C(=O)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O4/c1-10(2,3)7(9(15)16)8(14)12(4)5-6(11)13/h7H,5H2,1-4H3,(H2,11,13)(H,15,16) |
| InChIKey | AKRONIBFPRUFGE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|