C15H19ClS — CID 116540293
3-[(3-chloro-1-methylcyclopentyl)methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 116540293) has the molecular formula C15H19ClS and a molecular weight of 266.84 g/mol. Its IUPAC name is 3-[(3-chloro-1-methylcyclopentyl)methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-[(3-chloro-1-methylcyclopentyl)methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 116540293 |
| Molecular Formula | C15H19ClS |
| Molecular Weight | 266.84 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-[(3-chloro-1-methylcyclopentyl)methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | CC1(CC2CSc3ccccc32)CCC(Cl)C1 |
| InChI | InChI=1S/C15H19ClS/c1-15(7-6-12(16)9-15)8-11-10-17-14-5-3-2-4-13(11)14/h2-5,11-12H,6-10H2,1H3 |
| InChIKey | TZCHTCKCZWHRDF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.84 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|