C15H19BrOS — CID 79226239
4-(bromomethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)oxane (PubChem CID 79226239) has the molecular formula C15H19BrOS and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-(bromomethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)oxane.
| Compound Name | 4-(bromomethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)oxane |
|---|---|
| PubChem CID | 79226239 |
| Molecular Formula | C15H19BrOS |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 4-(bromomethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)oxane |
| SMILES | BrCC1(CC2CSc3ccccc32)CCOCC1 |
| InChI | InChI=1S/C15H19BrOS/c16-11-15(5-7-17-8-6-15)9-12-10-18-14-4-2-1-3-13(12)14/h1-4,12H,5-11H2 |
| InChIKey | UDYYLUOOTVNBEV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|