About 6-methyl-1-(4,4,4-trifluorobutyl)indole
6-methyl-1-(4,4,4-trifluorobutyl)indole (PubChem CID 116546672) has the molecular formula C13H14F3N
and a molecular weight of 241.26 g/mol. Its IUPAC name is 6-methyl-1-(4,4,4-trifluorobutyl)indole.
Molecular Properties
| Compound Name | 6-methyl-1-(4,4,4-trifluorobutyl)indole |
| PubChem CID | 116546672 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-methyl-1-(4,4,4-trifluorobutyl)indole |
| SMILES | Cc1ccc2ccn(CCCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H14F3N/c1-10-3-4-11-5-8-17(12(11)9-10)7-2-6-13(14,15)16/h3-5,8-9H,2,6-7H2,1H3 |
| InChIKey | HKAWQWMDBOUELC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-1-(4,4,4-trifluorobutyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-(4,4,4-trifluorobutyl)indole?
The IUPAC name of 6-methyl-1-(4,4,4-trifluorobutyl)indole (CID 116546672) is 6-methyl-1-(4,4,4-trifluorobutyl)indole.
What is the SMILES notation for 6-methyl-1-(4,4,4-trifluorobutyl)indole?
The canonical SMILES for 6-methyl-1-(4,4,4-trifluorobutyl)indole is Cc1ccc2ccn(CCCC(F)(F)F)c2c1.
What is the InChIKey of 6-methyl-1-(4,4,4-trifluorobutyl)indole?
The InChIKey is HKAWQWMDBOUELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N/c1-10-3-4-11-5-8-17(12(11)9-10)7-2-6-13(14,15)16/h3-5,8-9H,2,6-7H2,1H3.
What are the key properties of 6-methyl-1-(4,4,4-trifluorobutyl)indole?
6-methyl-1-(4,4,4-trifluorobutyl)indole has a molecular weight of 241.26 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-(4,4,4-trifluorobutyl)indole is sourced from PubChem (CID 116546672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).