C14H15N3O — CID 116546884
2-ethyl-5-[(6-methylindol-1-yl)methyl]-1,3,4-oxadiazole (PubChem CID 116546884) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-ethyl-5-[(6-methylindol-1-yl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-ethyl-5-[(6-methylindol-1-yl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 116546884 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-ethyl-5-[(6-methylindol-1-yl)methyl]-1,3,4-oxadiazole |
| SMILES | CCc1nnc(Cn2ccc3ccc(C)cc32)o1 |
| InChI | InChI=1S/C14H15N3O/c1-3-13-15-16-14(18-13)9-17-7-6-11-5-4-10(2)8-12(11)17/h4-8H,3,9H2,1-2H3 |
| InChIKey | ZOLIQZIXOLZMEB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |