C14H13ClN2O — CID 116620548
2-[(6-chloroindol-1-yl)methyl]-4,5-dimethyl-1,3-oxazole (PubChem CID 116620548) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-[(6-chloroindol-1-yl)methyl]-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-[(6-chloroindol-1-yl)methyl]-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 116620548 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-[(6-chloroindol-1-yl)methyl]-4,5-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(Cn2ccc3ccc(Cl)cc32)oc1C |
| InChI | InChI=1S/C14H13ClN2O/c1-9-10(2)18-14(16-9)8-17-6-5-11-3-4-12(15)7-13(11)17/h3-7H,8H2,1-2H3 |
| InChIKey | NGIZAZFAVBNSTL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |