C20H28O12 — CID 11655536
[(2R,3S,4S,5R,6R)-2,3,4,5,6-pentaacetyloxyoct-7-enyl] acetate (PubChem CID 11655536) has the molecular formula C20H28O12 and a molecular weight of 460.43 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2,3,4,5,6-pentaacetyloxyoct-7-enyl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-2,3,4,5,6-pentaacetyloxyoct-7-enyl] acetate |
|---|---|
| PubChem CID | 11655536 |
| Molecular Formula | C20H28O12 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2,3,4,5,6-pentaacetyloxyoct-7-enyl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H28O12/c1-8-16(28-11(3)22)18(30-13(5)24)20(32-15(7)26)19(31-14(6)25)17(29-12(4)23)9-27-10(2)21/h8,16-20H,1,9H2,2-7H3/t16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | YFPFZTFYKYQWLC-UEDWAMCQSA-N |
| XLogP | 0.39 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|