About 2-aminooctan-4-one
2-aminooctan-4-one (PubChem CID 116555826) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-aminooctan-4-one.
Molecular Properties
| Compound Name | 2-aminooctan-4-one |
| PubChem CID | 116555826 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-aminooctan-4-one |
| SMILES | CCCCC(=O)CC(C)N |
| InChI | InChI=1S/C8H17NO/c1-3-4-5-8(10)6-7(2)9/h7H,3-6,9H2,1-2H3 |
| InChIKey | TYTQEZBNVZNNAQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminooctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooctan-4-one?
The IUPAC name of 2-aminooctan-4-one (CID 116555826) is 2-aminooctan-4-one.
What is the SMILES notation for 2-aminooctan-4-one?
The canonical SMILES for 2-aminooctan-4-one is CCCCC(=O)CC(C)N.
What is the InChIKey of 2-aminooctan-4-one?
The InChIKey is TYTQEZBNVZNNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-4-5-8(10)6-7(2)9/h7H,3-6,9H2,1-2H3.
What are the key properties of 2-aminooctan-4-one?
2-aminooctan-4-one has a molecular weight of 143.23 g/mol, XLogP of 1.48, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooctan-4-one is sourced from PubChem (CID 116555826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).