About 5-aminohex-1-yn-3-one
5-aminohex-1-yn-3-one (PubChem CID 116555909) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 5-aminohex-1-yn-3-one.
Molecular Properties
| Compound Name | 5-aminohex-1-yn-3-one |
| PubChem CID | 116555909 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 5-aminohex-1-yn-3-one |
| SMILES | C#CC(=O)CC(C)N |
| InChI | InChI=1S/C6H9NO/c1-3-6(8)4-5(2)7/h1,5H,4,7H2,2H3 |
| InChIKey | SBBDZYDCGCYDGM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-aminohex-1-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminohex-1-yn-3-one?
The IUPAC name of 5-aminohex-1-yn-3-one (CID 116555909) is 5-aminohex-1-yn-3-one.
What is the SMILES notation for 5-aminohex-1-yn-3-one?
The canonical SMILES for 5-aminohex-1-yn-3-one is C#CC(=O)CC(C)N.
What is the InChIKey of 5-aminohex-1-yn-3-one?
The InChIKey is SBBDZYDCGCYDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-3-6(8)4-5(2)7/h1,5H,4,7H2,2H3.
What are the key properties of 5-aminohex-1-yn-3-one?
5-aminohex-1-yn-3-one has a molecular weight of 111.14 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminohex-1-yn-3-one is sourced from PubChem (CID 116555909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).