About actinium;4-oxopentan-2-ylazanide
actinium;4-oxopentan-2-ylazanide (PubChem CID 20760022) has the molecular formula C5H10AcNO-
and a molecular weight of 327.14 g/mol. Its IUPAC name is actinium;4-oxopentan-2-ylazanide.
Molecular Properties
| Compound Name | actinium;4-oxopentan-2-ylazanide |
| PubChem CID | 20760022 |
| Molecular Formula | C5H10AcNO- |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | actinium;4-oxopentan-2-ylazanide |
| SMILES | CC(=O)CC(C)[NH-].[Ac] |
| InChI | InChI=1S/C5H10NO.Ac/c1-4(6)3-5(2)7;/h4,6H,3H2,1-2H3;/q-1; |
| InChIKey | DVVSBKLUCPSMFV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze actinium;4-oxopentan-2-ylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;4-oxopentan-2-ylazanide?
The IUPAC name of actinium;4-oxopentan-2-ylazanide (CID 20760022) is actinium;4-oxopentan-2-ylazanide.
What is the SMILES notation for actinium;4-oxopentan-2-ylazanide?
The canonical SMILES for actinium;4-oxopentan-2-ylazanide is CC(=O)CC(C)[NH-].[Ac].
What is the InChIKey of actinium;4-oxopentan-2-ylazanide?
The InChIKey is DVVSBKLUCPSMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO.Ac/c1-4(6)3-5(2)7;/h4,6H,3H2,1-2H3;/q-1;.
What are the key properties of actinium;4-oxopentan-2-ylazanide?
actinium;4-oxopentan-2-ylazanide has a molecular weight of 327.14 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;4-oxopentan-2-ylazanide is sourced from PubChem (CID 20760022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).