C15H23NO — CID 116573662
4-amino-3,3,4-trimethyl-1-(4-methylphenyl)pentan-2-one (PubChem CID 116573662) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-amino-3,3,4-trimethyl-1-(4-methylphenyl)pentan-2-one.
| Compound Name | 4-amino-3,3,4-trimethyl-1-(4-methylphenyl)pentan-2-one |
|---|---|
| PubChem CID | 116573662 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-amino-3,3,4-trimethyl-1-(4-methylphenyl)pentan-2-one |
| SMILES | Cc1ccc(CC(=O)C(C)(C)C(C)(C)N)cc1 |
| InChI | InChI=1S/C15H23NO/c1-11-6-8-12(9-7-11)10-13(17)14(2,3)15(4,5)16/h6-9H,10,16H2,1-5H3 |
| InChIKey | RSNWDGWURAQWBT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |