C13H21NO2 — CID 116574856
7-amino-1-(furan-2-yl)-5,5-dimethylheptan-2-one (PubChem CID 116574856) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 7-amino-1-(furan-2-yl)-5,5-dimethylheptan-2-one.
| Compound Name | 7-amino-1-(furan-2-yl)-5,5-dimethylheptan-2-one |
|---|---|
| PubChem CID | 116574856 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 7-amino-1-(furan-2-yl)-5,5-dimethylheptan-2-one |
| SMILES | CC(C)(CCN)CCC(=O)Cc1ccco1 |
| InChI | InChI=1S/C13H21NO2/c1-13(2,7-8-14)6-5-11(15)10-12-4-3-9-16-12/h3-4,9H,5-8,10,14H2,1-2H3 |
| InChIKey | LSCVNNMBDBUFBS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |