C9H8O5 — CID 44591401
5-(furan-2-yl)-2,4-dioxopentanoic acid (PubChem CID 44591401) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is 5-(furan-2-yl)-2,4-dioxopentanoic acid.
| Compound Name | 5-(furan-2-yl)-2,4-dioxopentanoic acid |
|---|---|
| PubChem CID | 44591401 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5-(furan-2-yl)-2,4-dioxopentanoic acid |
| SMILES | O=C(CC(=O)C(=O)O)Cc1ccco1 |
| InChI | InChI=1S/C9H8O5/c10-6(5-8(11)9(12)13)4-7-2-1-3-14-7/h1-3H,4-5H2,(H,12,13) |
| InChIKey | HGYDCJNEHNITQX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|