C12H19NO2 — CID 116608493
4-amino-1-(furan-2-yl)-5,5-dimethylhexan-2-one (PubChem CID 116608493) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-amino-1-(furan-2-yl)-5,5-dimethylhexan-2-one.
| Compound Name | 4-amino-1-(furan-2-yl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 116608493 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 4-amino-1-(furan-2-yl)-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)C(N)CC(=O)Cc1ccco1 |
| InChI | InChI=1S/C12H19NO2/c1-12(2,3)11(13)8-9(14)7-10-5-4-6-15-10/h4-6,11H,7-8,13H2,1-3H3 |
| InChIKey | BXYRSFIVASDZIW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |